C17H15ClF3N3O2 — CID 145441016
1-[(3-chloroquinolin-6-yl)methyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid;ethane (PubChem CID 145441016) has the molecular formula C17H15ClF3N3O2 and a molecular weight of 385.77 g/mol. Its IUPAC name is 1-[(3-chloroquinolin-6-yl)methyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid;ethane.
| Compound Name | 1-[(3-chloroquinolin-6-yl)methyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 145441016 |
| Molecular Formula | C17H15ClF3N3O2 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 1-[(3-chloroquinolin-6-yl)methyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid;ethane |
| SMILES | CC.O=C(O)c1nn(Cc2ccc3ncc(Cl)cc3c2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H9ClF3N3O2.C2H6/c16-10-4-9-3-8(1-2-12(9)20-5-10)6-22-7-11(15(17,18)19)13(21-22)14(23)24;1-2/h1-5,7H,6H2,(H,23,24);1-2H3 |
| InChIKey | BXSGPUOPLRIQSZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |