C19H26ClN3O4 — CID 145441118
ethane;ethyl 2-[2-[2-(3-chloroquinolin-6-yl)acetyl]hydrazinyl]-2-oxoacetate (PubChem CID 145441118) has the molecular formula C19H26ClN3O4 and a molecular weight of 395.89 g/mol. Its IUPAC name is ethane;ethyl 2-[2-[2-(3-chloroquinolin-6-yl)acetyl]hydrazinyl]-2-oxoacetate.
| Compound Name | ethane;ethyl 2-[2-[2-(3-chloroquinolin-6-yl)acetyl]hydrazinyl]-2-oxoacetate |
|---|---|
| PubChem CID | 145441118 |
| Molecular Formula | C19H26ClN3O4 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | ethane;ethyl 2-[2-[2-(3-chloroquinolin-6-yl)acetyl]hydrazinyl]-2-oxoacetate |
| SMILES | CC.CC.CCOC(=O)C(=O)NNC(=O)Cc1ccc2ncc(Cl)cc2c1 |
| InChI | InChI=1S/C15H14ClN3O4.2C2H6/c1-2-23-15(22)14(21)19-18-13(20)6-9-3-4-12-10(5-9)7-11(16)8-17-12;2*1-2/h3-5,7-8H,2,6H2,1H3,(H,18,20)(H,19,21);2*1-2H3 |
| InChIKey | NPGSIZOLFFFMDK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|