C16H16ClF3N4O2 — CID 145441196
ethyl (Z)-3-amino-2-[amino-[(3-chloroquinolin-6-yl)methyl]amino]-4,4,4-trifluorobut-2-enoate (PubChem CID 145441196) has the molecular formula C16H16ClF3N4O2 and a molecular weight of 388.78 g/mol. Its IUPAC name is ethyl (Z)-3-amino-2-[amino-[(3-chloroquinolin-6-yl)methyl]amino]-4,4,4-trifluorobut-2-enoate.
| Compound Name | ethyl (Z)-3-amino-2-[amino-[(3-chloroquinolin-6-yl)methyl]amino]-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 145441196 |
| Molecular Formula | C16H16ClF3N4O2 |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | ethyl (Z)-3-amino-2-[amino-[(3-chloroquinolin-6-yl)methyl]amino]-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C(=C(/N)C(F)(F)F)N(N)Cc1ccc2ncc(Cl)cc2c1 |
| InChI | InChI=1S/C16H16ClF3N4O2/c1-2-26-15(25)13(14(21)16(18,19)20)24(22)8-9-3-4-12-10(5-9)6-11(17)7-23-12/h3-7H,2,8,21-22H2,1H3/b14-13- |
| InChIKey | MDWFFDUDDNWOFH-YPKPFQOOSA-N |
| XLogP | 2.86 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|