C17H10Cl2IN3 — CID 134178697
3-chloro-6-[(4-chloro-3-iodopyrrolo[3,2-c]pyridin-1-yl)methyl]quinoline (PubChem CID 134178697) has the molecular formula C17H10Cl2IN3 and a molecular weight of 454.10 g/mol. Its IUPAC name is 3-chloro-6-[(4-chloro-3-iodopyrrolo[3,2-c]pyridin-1-yl)methyl]quinoline.
| Compound Name | 3-chloro-6-[(4-chloro-3-iodopyrrolo[3,2-c]pyridin-1-yl)methyl]quinoline |
|---|---|
| PubChem CID | 134178697 |
| Molecular Formula | C17H10Cl2IN3 |
| Molecular Weight | 454.10 g/mol |
| Exact Mass | 452.93 |
| IUPAC Name | 3-chloro-6-[(4-chloro-3-iodopyrrolo[3,2-c]pyridin-1-yl)methyl]quinoline |
| SMILES | Clc1cnc2ccc(Cn3cc(I)c4c(Cl)nccc43)cc2c1 |
| InChI | InChI=1S/C17H10Cl2IN3/c18-12-6-11-5-10(1-2-14(11)22-7-12)8-23-9-13(20)16-15(23)3-4-21-17(16)19/h1-7,9H,8H2 |
| InChIKey | FUMQZQLFMDRYPQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.10 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|