C21H17ClN4O2 — CID 155129255
1-[(3-chloroquinolin-6-yl)methyl]-3-(methoxymethoxymethyl)pyrrolo[2,3-c]pyridine-5-carbonitrile (PubChem CID 155129255) has the molecular formula C21H17ClN4O2 and a molecular weight of 392.85 g/mol. Its IUPAC name is 1-[(3-chloroquinolin-6-yl)methyl]-3-(methoxymethoxymethyl)pyrrolo[2,3-c]pyridine-5-carbonitrile.
| Compound Name | 1-[(3-chloroquinolin-6-yl)methyl]-3-(methoxymethoxymethyl)pyrrolo[2,3-c]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 155129255 |
| Molecular Formula | C21H17ClN4O2 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-[(3-chloroquinolin-6-yl)methyl]-3-(methoxymethoxymethyl)pyrrolo[2,3-c]pyridine-5-carbonitrile |
| SMILES | COCOCc1cn(Cc2ccc3ncc(Cl)cc3c2)c2cnc(C#N)cc12 |
| InChI | InChI=1S/C21H17ClN4O2/c1-27-13-28-12-16-11-26(21-9-24-18(7-23)6-19(16)21)10-14-2-3-20-15(4-14)5-17(22)8-25-20/h2-6,8-9,11H,10,12-13H2,1H3 |
| InChIKey | YYCQUGRDTKMIFR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|