C19H30N2O4S — CID 134179062
4-hexoxy-N-[(2S)-1-(hydroxyamino)-5-methylsulfanyl-1-oxopentan-2-yl]benzamide (PubChem CID 134179062) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is 4-hexoxy-N-[(2S)-1-(hydroxyamino)-5-methylsulfanyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-hexoxy-N-[(2S)-1-(hydroxyamino)-5-methylsulfanyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 134179062 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 4-hexoxy-N-[(2S)-1-(hydroxyamino)-5-methylsulfanyl-1-oxopentan-2-yl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)N[C@@H](CCCSC)C(=O)NO)cc1 |
| InChI | InChI=1S/C19H30N2O4S/c1-3-4-5-6-13-25-16-11-9-15(10-12-16)18(22)20-17(19(23)21-24)8-7-14-26-2/h9-12,17,24H,3-8,13-14H2,1-2H3,(H,20,22)(H,21,23)/t17-/m0/s1 |
| InChIKey | RKQNOLDHUQKMQF-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|