C18H15Cl2N3O — CID 134180144
3,5-dichloro-4-[1-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]aniline (PubChem CID 134180144) has the molecular formula C18H15Cl2N3O and a molecular weight of 360.24 g/mol. Its IUPAC name is 3,5-dichloro-4-[1-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]aniline.
| Compound Name | 3,5-dichloro-4-[1-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]aniline |
|---|---|
| PubChem CID | 134180144 |
| Molecular Formula | C18H15Cl2N3O |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 3,5-dichloro-4-[1-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]aniline |
| SMILES | Cc1ccc(-c2nc(C3(c4c(Cl)cc(N)cc4Cl)CC3)no2)cc1 |
| InChI | InChI=1S/C18H15Cl2N3O/c1-10-2-4-11(5-3-10)16-22-17(23-24-16)18(6-7-18)15-13(19)8-12(21)9-14(15)20/h2-5,8-9H,6-7,21H2,1H3 |
| InChIKey | KQTDLRWIAJAZBB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|