About 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline
5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 29274687) has the molecular formula C14H10ClN3O
and a molecular weight of 271.71 g/mol. Its IUPAC name is 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline.
Molecular Properties
| Compound Name | 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline |
| PubChem CID | 29274687 |
| Molecular Formula | C14H10ClN3O |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | Nc1cc(Cl)ccc1-c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C14H10ClN3O/c15-10-6-7-11(12(16)8-10)14-17-13(18-19-14)9-4-2-1-3-5-9/h1-8H,16H2 |
| InChIKey | KSCDMIPPJAMZBZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline?
The IUPAC name of 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline (CID 29274687) is 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline.
What is the SMILES notation for 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline?
The canonical SMILES for 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline is Nc1cc(Cl)ccc1-c1nc(-c2ccccc2)no1.
What is the InChIKey of 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline?
The InChIKey is KSCDMIPPJAMZBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClN3O/c15-10-6-7-11(12(16)8-10)14-17-13(18-19-14)9-4-2-1-3-5-9/h1-8H,16H2.
What are the key properties of 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline?
5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline has a molecular weight of 271.71 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline is sourced from PubChem (CID 29274687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).