C26H23FN4O4S2 — CID 134180972
4-fluoro-N-[2-[[2-(2-methoxy-7-methylquinoxalin-5-yl)-4-methyl-1,3-benzothiazol-6-yl]oxy]ethyl]benzenesulfonamide (PubChem CID 134180972) has the molecular formula C26H23FN4O4S2 and a molecular weight of 538.63 g/mol. Its IUPAC name is 4-fluoro-N-[2-[[2-(2-methoxy-7-methylquinoxalin-5-yl)-4-methyl-1,3-benzothiazol-6-yl]oxy]ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[[2-(2-methoxy-7-methylquinoxalin-5-yl)-4-methyl-1,3-benzothiazol-6-yl]oxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134180972 |
| Molecular Formula | C26H23FN4O4S2 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 4-fluoro-N-[2-[[2-(2-methoxy-7-methylquinoxalin-5-yl)-4-methyl-1,3-benzothiazol-6-yl]oxy]ethyl]benzenesulfonamide |
| SMILES | COc1cnc2c(-c3nc4c(C)cc(OCCNS(=O)(=O)c5ccc(F)cc5)cc4s3)cc(C)cc2n1 |
| InChI | InChI=1S/C26H23FN4O4S2/c1-15-10-20(25-21(11-15)30-23(34-3)14-28-25)26-31-24-16(2)12-18(13-22(24)36-26)35-9-8-29-37(32,33)19-6-4-17(27)5-7-19/h4-7,10-14,29H,8-9H2,1-3H3 |
| InChIKey | PVEHCCXPQHLPHP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|