C27H25FN4O3S2 — CID 134181151
N-[2-[[2-(2-ethyl-7-methylquinoxalin-5-yl)-4-methyl-1,3-benzothiazol-6-yl]oxy]ethyl]-4-fluorobenzenesulfonamide (PubChem CID 134181151) has the molecular formula C27H25FN4O3S2 and a molecular weight of 536.65 g/mol. Its IUPAC name is N-[2-[[2-(2-ethyl-7-methylquinoxalin-5-yl)-4-methyl-1,3-benzothiazol-6-yl]oxy]ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-[[2-(2-ethyl-7-methylquinoxalin-5-yl)-4-methyl-1,3-benzothiazol-6-yl]oxy]ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 134181151 |
| Molecular Formula | C27H25FN4O3S2 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | N-[2-[[2-(2-ethyl-7-methylquinoxalin-5-yl)-4-methyl-1,3-benzothiazol-6-yl]oxy]ethyl]-4-fluorobenzenesulfonamide |
| SMILES | CCc1cnc2c(-c3nc4c(C)cc(OCCNS(=O)(=O)c5ccc(F)cc5)cc4s3)cc(C)cc2n1 |
| InChI | InChI=1S/C27H25FN4O3S2/c1-4-19-15-29-26-22(11-16(2)12-23(26)31-19)27-32-25-17(3)13-20(14-24(25)36-27)35-10-9-30-37(33,34)21-7-5-18(28)6-8-21/h5-8,11-15,30H,4,9-10H2,1-3H3 |
| InChIKey | KLVKZINGGHTVEQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|