C25H20ClFN6O3S — CID 134181397
1-[2-[[4-chloro-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]ethyl]-3-pyridin-3-ylurea (PubChem CID 134181397) has the molecular formula C25H20ClFN6O3S and a molecular weight of 538.99 g/mol. Its IUPAC name is 1-[2-[[4-chloro-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]ethyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[2-[[4-chloro-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]ethyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 134181397 |
| Molecular Formula | C25H20ClFN6O3S |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 1-[2-[[4-chloro-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]ethyl]-3-pyridin-3-ylurea |
| SMILES | COc1cnc2c(-c3nc4c(Cl)c(F)c(OCCNC(=O)Nc5cccnc5)cc4s3)cc(C)cc2n1 |
| InChI | InChI=1S/C25H20ClFN6O3S/c1-13-8-15(22-16(9-13)32-19(35-2)12-30-22)24-33-23-18(37-24)10-17(21(27)20(23)26)36-7-6-29-25(34)31-14-4-3-5-28-11-14/h3-5,8-12H,6-7H2,1-2H3,(H2,29,31,34) |
| InChIKey | WVCWSPOJXHESRO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|