C13H13N7OS — CID 134184413
1-(6-aminopyrazin-2-yl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 134184413) has the molecular formula C13H13N7OS and a molecular weight of 315.36 g/mol. Its IUPAC name is 1-(6-aminopyrazin-2-yl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(6-aminopyrazin-2-yl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 134184413 |
| Molecular Formula | C13H13N7OS |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-(6-aminopyrazin-2-yl)-6-methylsulfanyl-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(SC)nc2n1-c1cncc(N)n1 |
| InChI | InChI=1S/C13H13N7OS/c1-3-4-19-12(21)8-5-16-13(22-2)18-11(8)20(19)10-7-15-6-9(14)17-10/h3,5-7H,1,4H2,2H3,(H2,14,17) |
| InChIKey | VIQPTPDKHQDGGA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|