C12H11NO2S — CID 134185382
5-(5-thiophen-2-ylfuran-2-yl)pyrrolidin-2-one (PubChem CID 134185382) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 5-(5-thiophen-2-ylfuran-2-yl)pyrrolidin-2-one.
| Compound Name | 5-(5-thiophen-2-ylfuran-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 134185382 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 5-(5-thiophen-2-ylfuran-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CCC(c2ccc(-c3cccs3)o2)N1 |
| InChI | InChI=1S/C12H11NO2S/c14-12-6-3-8(13-12)9-4-5-10(15-9)11-2-1-7-16-11/h1-2,4-5,7-8H,3,6H2,(H,13,14) |
| InChIKey | AYJKDTYQUFCWFX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |