C17H24O9 — CID 134185984
(4,5-diacetyloxy-3-hydroxy-6-penta-2,3-dienoxyoxan-2-yl)methyl acetate (PubChem CID 134185984) has the molecular formula C17H24O9 and a molecular weight of 372.37 g/mol. Its IUPAC name is (4,5-diacetyloxy-3-hydroxy-6-penta-2,3-dienoxyoxan-2-yl)methyl acetate.
| Compound Name | (4,5-diacetyloxy-3-hydroxy-6-penta-2,3-dienoxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 134185984 |
| Molecular Formula | C17H24O9 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (4,5-diacetyloxy-3-hydroxy-6-penta-2,3-dienoxyoxan-2-yl)methyl acetate |
| SMILES | CC=C=CCOC1OC(COC(C)=O)C(O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H24O9/c1-5-6-7-8-22-17-16(25-12(4)20)15(24-11(3)19)14(21)13(26-17)9-23-10(2)18/h5,7,13-17,21H,8-9H2,1-4H3 |
| InChIKey | BIZPILLPYIAKEY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|