C23H30FN7O3 — CID 134188098
5-fluoro-6-(2-iminohexan-3-ylamino)-2-[[3-methoxy-1-(2-methoxyethyl)indazol-5-yl]amino]pyridine-3-carboxamide (PubChem CID 134188098) has the molecular formula C23H30FN7O3 and a molecular weight of 471.54 g/mol. Its IUPAC name is 5-fluoro-6-(2-iminohexan-3-ylamino)-2-[[3-methoxy-1-(2-methoxyethyl)indazol-5-yl]amino]pyridine-3-carboxamide.
| Compound Name | 5-fluoro-6-(2-iminohexan-3-ylamino)-2-[[3-methoxy-1-(2-methoxyethyl)indazol-5-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134188098 |
| Molecular Formula | C23H30FN7O3 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 5-fluoro-6-(2-iminohexan-3-ylamino)-2-[[3-methoxy-1-(2-methoxyethyl)indazol-5-yl]amino]pyridine-3-carboxamide |
| SMILES | [H]/N=C(\C)C(CCC)Nc1nc(Nc2ccc3c(c2)c(OC)nn3CCOC)c(C(N)=O)cc1F |
| InChI | InChI=1S/C23H30FN7O3/c1-5-6-18(13(2)25)28-22-17(24)12-16(20(26)32)21(29-22)27-14-7-8-19-15(11-14)23(34-4)30-31(19)9-10-33-3/h7-8,11-12,18,25H,5-6,9-10H2,1-4H3,(H2,26,32)(H2,27,28,29)/b25-13+ |
| InChIKey | WBPKZPGXCJHSPZ-DHRITJCHSA-N |
| XLogP | 3.69 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|