C17H18FN5O3 — CID 141442617
6-fluoro-2-[[3-methoxy-1-(2-methoxyethyl)indazol-5-yl]amino]pyridine-3-carboxamide (PubChem CID 141442617) has the molecular formula C17H18FN5O3 and a molecular weight of 359.36 g/mol. Its IUPAC name is 6-fluoro-2-[[3-methoxy-1-(2-methoxyethyl)indazol-5-yl]amino]pyridine-3-carboxamide.
| Compound Name | 6-fluoro-2-[[3-methoxy-1-(2-methoxyethyl)indazol-5-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141442617 |
| Molecular Formula | C17H18FN5O3 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 6-fluoro-2-[[3-methoxy-1-(2-methoxyethyl)indazol-5-yl]amino]pyridine-3-carboxamide |
| SMILES | COCCn1nc(OC)c2cc(Nc3nc(F)ccc3C(N)=O)ccc21 |
| InChI | InChI=1S/C17H18FN5O3/c1-25-8-7-23-13-5-3-10(9-12(13)17(22-23)26-2)20-16-11(15(19)24)4-6-14(18)21-16/h3-6,9H,7-8H2,1-2H3,(H2,19,24)(H,20,21) |
| InChIKey | PCBXPNYPXLNGSI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|