C18H17N5O — CID 134190171
3-cyclopentyl-N-(2H-pyrazolo[3,4-b]pyridin-3-yl)-1,2-benzoxazol-6-amine (PubChem CID 134190171) has the molecular formula C18H17N5O and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-cyclopentyl-N-(2H-pyrazolo[3,4-b]pyridin-3-yl)-1,2-benzoxazol-6-amine.
| Compound Name | 3-cyclopentyl-N-(2H-pyrazolo[3,4-b]pyridin-3-yl)-1,2-benzoxazol-6-amine |
|---|---|
| PubChem CID | 134190171 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-cyclopentyl-N-(2H-pyrazolo[3,4-b]pyridin-3-yl)-1,2-benzoxazol-6-amine |
| SMILES | C1CCC(C1)C2=NOC3=C2C=CC(=C3)NC4=C5C=CC=NC5=NN4 |
| InChI | InChI=1S/C18H17N5O/c1-2-5-11(4-1)16-13-8-7-12(10-15(13)24-23-16)20-18-14-6-3-9-19-17(14)21-22-18/h3,6-11H,1-2,4-5H2,(H2,19,20,21,22) |
| InChIKey | OGLVFFJPJFVZQX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | 443 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |