C19H23FO3 — CID 134190523
8-fluoro-7-[(E)-pent-3-enoxy]-3-pentylisochromen-1-one (PubChem CID 134190523) has the molecular formula C19H23FO3 and a molecular weight of 318.39 g/mol. Its IUPAC name is 8-fluoro-7-[(E)-pent-3-enoxy]-3-pentylisochromen-1-one.
| Compound Name | 8-fluoro-7-[(E)-pent-3-enoxy]-3-pentylisochromen-1-one |
|---|---|
| PubChem CID | 134190523 |
| Molecular Formula | C19H23FO3 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 8-fluoro-7-[(E)-pent-3-enoxy]-3-pentylisochromen-1-one |
| SMILES | C/C=C/CCOc1ccc2cc(CCCCC)oc(=O)c2c1F |
| InChI | InChI=1S/C19H23FO3/c1-3-5-7-9-15-13-14-10-11-16(22-12-8-6-4-2)18(20)17(14)19(21)23-15/h4,6,10-11,13H,3,5,7-9,12H2,1-2H3/b6-4+ |
| InChIKey | TZUAXGFRXHPNSX-GQCTYLIASA-N |
| XLogP | 5.01 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|