C22H29FO3 — CID 134190535
8-fluoro-3-octyl-7-[(E)-pent-3-enoxy]isochromen-1-one (PubChem CID 134190535) has the molecular formula C22H29FO3 and a molecular weight of 360.47 g/mol. Its IUPAC name is 8-fluoro-3-octyl-7-[(E)-pent-3-enoxy]isochromen-1-one.
| Compound Name | 8-fluoro-3-octyl-7-[(E)-pent-3-enoxy]isochromen-1-one |
|---|---|
| PubChem CID | 134190535 |
| Molecular Formula | C22H29FO3 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 8-fluoro-3-octyl-7-[(E)-pent-3-enoxy]isochromen-1-one |
| SMILES | C/C=C/CCOc1ccc2cc(CCCCCCCC)oc(=O)c2c1F |
| InChI | InChI=1S/C22H29FO3/c1-3-5-7-8-9-10-12-18-16-17-13-14-19(25-15-11-6-4-2)21(23)20(17)22(24)26-18/h4,6,13-14,16H,3,5,7-12,15H2,1-2H3/b6-4+ |
| InChIKey | PSDCOARLQBBKFX-GQCTYLIASA-N |
| XLogP | 6.18 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|