C21H20BrNO — CID 134195045
1-[1-(4-bromophenyl)-5-(3,4-dimethylphenyl)-2-methylpyrrol-3-yl]ethanone (PubChem CID 134195045) has the molecular formula C21H20BrNO and a molecular weight of 382.30 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)-5-(3,4-dimethylphenyl)-2-methylpyrrol-3-yl]ethanone.
| Compound Name | 1-[1-(4-bromophenyl)-5-(3,4-dimethylphenyl)-2-methylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 134195045 |
| Molecular Formula | C21H20BrNO |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-[1-(4-bromophenyl)-5-(3,4-dimethylphenyl)-2-methylpyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1cc(-c2ccc(C)c(C)c2)n(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C21H20BrNO/c1-13-5-6-17(11-14(13)2)21-12-20(16(4)24)15(3)23(21)19-9-7-18(22)8-10-19/h5-12H,1-4H3 |
| InChIKey | ZXXVUJPHURTJSF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|