C19H14S — CID 134198751
4-methylsulfanylbenzo[a]anthracene (PubChem CID 134198751) has the molecular formula C19H14S and a molecular weight of 274.39 g/mol. Its IUPAC name is 4-methylsulfanylbenzo[a]anthracene.
| Compound Name | 4-methylsulfanylbenzo[a]anthracene |
|---|---|
| PubChem CID | 134198751 |
| Molecular Formula | C19H14S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-methylsulfanylbenzo[a]anthracene |
| SMILES | CSc1cccc2c1ccc1cc3ccccc3cc12 |
| InChI | InChI=1S/C19H14S/c1-20-19-8-4-7-16-17(19)10-9-15-11-13-5-2-3-6-14(13)12-18(15)16/h2-12H,1H3 |
| InChIKey | MZZJONPLMIGRBK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|