C12H13F4N — CID 134199954
(2S,5R)-2-(3-fluorophenyl)-5-(2,2,2-trifluoroethyl)pyrrolidine (PubChem CID 134199954) has the molecular formula C12H13F4N and a molecular weight of 247.23 g/mol. Its IUPAC name is (2S,5R)-2-(3-fluorophenyl)-5-(2,2,2-trifluoroethyl)pyrrolidine.
| Compound Name | (2S,5R)-2-(3-fluorophenyl)-5-(2,2,2-trifluoroethyl)pyrrolidine |
|---|---|
| PubChem CID | 134199954 |
| Molecular Formula | C12H13F4N |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (2S,5R)-2-(3-fluorophenyl)-5-(2,2,2-trifluoroethyl)pyrrolidine |
| SMILES | Fc1cccc([C@@H]2CC[C@H](CC(F)(F)F)N2)c1 |
| InChI | InChI=1S/C12H13F4N/c13-9-3-1-2-8(6-9)11-5-4-10(17-11)7-12(14,15)16/h1-3,6,10-11,17H,4-5,7H2/t10-,11+/m1/s1 |
| InChIKey | CILZHYZZUOCCGI-MNOVXSKESA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |