C13H8F3N3O2S — CID 134201873
4-[2-methylsulfonyl-6-(trifluoromethyl)pyrimidin-4-yl]benzonitrile (PubChem CID 134201873) has the molecular formula C13H8F3N3O2S and a molecular weight of 327.29 g/mol. Its IUPAC name is 4-[2-methylsulfonyl-6-(trifluoromethyl)pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[2-methylsulfonyl-6-(trifluoromethyl)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 134201873 |
| Molecular Formula | C13H8F3N3O2S |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 4-[2-methylsulfonyl-6-(trifluoromethyl)pyrimidin-4-yl]benzonitrile |
| SMILES | CS(=O)(=O)c1nc(-c2ccc(C#N)cc2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H8F3N3O2S/c1-22(20,21)12-18-10(6-11(19-12)13(14,15)16)9-4-2-8(7-17)3-5-9/h2-6H,1H3 |
| InChIKey | XKRCNTBJFCKVNU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |