C15H11F3N2O3S — CID 134201816
2-methylsulfonyl-4-(3-prop-2-ynoxyphenyl)-6-(trifluoromethyl)pyrimidine (PubChem CID 134201816) has the molecular formula C15H11F3N2O3S and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-methylsulfonyl-4-(3-prop-2-ynoxyphenyl)-6-(trifluoromethyl)pyrimidine.
| Compound Name | 2-methylsulfonyl-4-(3-prop-2-ynoxyphenyl)-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 134201816 |
| Molecular Formula | C15H11F3N2O3S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-methylsulfonyl-4-(3-prop-2-ynoxyphenyl)-6-(trifluoromethyl)pyrimidine |
| SMILES | C#CCOc1cccc(-c2cc(C(F)(F)F)nc(S(C)(=O)=O)n2)c1 |
| InChI | InChI=1S/C15H11F3N2O3S/c1-3-7-23-11-6-4-5-10(8-11)12-9-13(15(16,17)18)20-14(19-12)24(2,21)22/h1,4-6,8-9H,7H2,2H3 |
| InChIKey | SSKADDFSWJPHBC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|