C13H25NS2 — CID 134203233
(3R,4R)-1-cyclobutyl-3-(disulfanyl)-4-(2-methylpropyl)piperidine (PubChem CID 134203233) has the molecular formula C13H25NS2 and a molecular weight of 259.48 g/mol. Its IUPAC name is (3R,4R)-1-cyclobutyl-3-(disulfanyl)-4-(2-methylpropyl)piperidine.
| Compound Name | (3R,4R)-1-cyclobutyl-3-(disulfanyl)-4-(2-methylpropyl)piperidine |
|---|---|
| PubChem CID | 134203233 |
| Molecular Formula | C13H25NS2 |
| Molecular Weight | 259.48 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (3R,4R)-1-cyclobutyl-3-(disulfanyl)-4-(2-methylpropyl)piperidine |
| SMILES | CC(C)C[C@@H]1CCN(C2CCC2)C[C@@H]1SS |
| InChI | InChI=1S/C13H25NS2/c1-10(2)8-11-6-7-14(9-13(11)16-15)12-4-3-5-12/h10-13,15H,3-9H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | JIGSJAHXLRDVOZ-AAEUAGOBSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|