C12H23NS — CID 134203262
1-[(3R,4R)-1-cyclopropyl-4-ethylpiperidin-3-yl]ethanethiol (PubChem CID 134203262) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is 1-[(3R,4R)-1-cyclopropyl-4-ethylpiperidin-3-yl]ethanethiol.
| Compound Name | 1-[(3R,4R)-1-cyclopropyl-4-ethylpiperidin-3-yl]ethanethiol |
|---|---|
| PubChem CID | 134203262 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 1-[(3R,4R)-1-cyclopropyl-4-ethylpiperidin-3-yl]ethanethiol |
| SMILES | CC[C@@H]1CCN(C2CC2)C[C@@H]1C(C)S |
| InChI | InChI=1S/C12H23NS/c1-3-10-6-7-13(11-4-5-11)8-12(10)9(2)14/h9-12,14H,3-8H2,1-2H3/t9?,10-,12-/m1/s1 |
| InChIKey | MUWZGVSJYUETAB-GTFYECCDSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|