C17H22Br2O4S — CID 13420338
4-(3,5-dibromo-4-methoxyphenyl)-2-hexylsulfanyl-4-oxobutanoic acid (PubChem CID 13420338) has the molecular formula C17H22Br2O4S and a molecular weight of 482.23 g/mol. Its IUPAC name is 4-(3,5-dibromo-4-methoxyphenyl)-2-hexylsulfanyl-4-oxobutanoic acid.
| Compound Name | 4-(3,5-dibromo-4-methoxyphenyl)-2-hexylsulfanyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 13420338 |
| Molecular Formula | C17H22Br2O4S |
| Molecular Weight | 482.23 g/mol |
| Exact Mass | 479.96 |
| IUPAC Name | 4-(3,5-dibromo-4-methoxyphenyl)-2-hexylsulfanyl-4-oxobutanoic acid |
| SMILES | CCCCCCSC(CC(=O)c1cc(Br)c(OC)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C17H22Br2O4S/c1-3-4-5-6-7-24-15(17(21)22)10-14(20)11-8-12(18)16(23-2)13(19)9-11/h8-9,15H,3-7,10H2,1-2H3,(H,21,22) |
| InChIKey | ZNCNPRQZVVSWLN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.23 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|