C28H36FN5O2 — CID 134204581
1-(cyclobutylmethyl)-3-[[5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl]amino]urea (PubChem CID 134204581) has the molecular formula C28H36FN5O2 and a molecular weight of 493.63 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-3-[[5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl]amino]urea.
| Compound Name | 1-(cyclobutylmethyl)-3-[[5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl]amino]urea |
|---|---|
| PubChem CID | 134204581 |
| Molecular Formula | C28H36FN5O2 |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 1-(cyclobutylmethyl)-3-[[5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl]amino]urea |
| SMILES | O=C(NCC1CCC1)NNC1C2CC3CC1CC(C(O)CC1c4c(F)cccc4-c4cncn41)(C3)C2 |
| InChI | InChI=1S/C28H36FN5O2/c29-21-6-2-5-20-23-14-30-15-34(23)22(25(20)21)9-24(35)28-10-17-7-18(11-28)26(19(8-17)12-28)32-33-27(36)31-13-16-3-1-4-16/h2,5-6,14-19,22,24,26,32,35H,1,3-4,7-13H2,(H2,31,33,36) |
| InChIKey | PXQYDNPBEJFLML-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|