C22H26FN2O5P — CID 134195247
[5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl] dihydrogen phosphate (PubChem CID 134195247) has the molecular formula C22H26FN2O5P and a molecular weight of 448.43 g/mol. Its IUPAC name is [5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl] dihydrogen phosphate.
| Compound Name | [5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 134195247 |
| Molecular Formula | C22H26FN2O5P |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1C2CC3CC1CC(C(O)CC1c4c(F)cccc4-c4cncn41)(C3)C2 |
| InChI | InChI=1S/C22H26FN2O5P/c23-16-3-1-2-15-18-10-24-11-25(18)17(20(15)16)6-19(26)22-7-12-4-13(8-22)21(14(5-12)9-22)30-31(27,28)29/h1-3,10-14,17,19,21,26H,4-9H2,(H2,27,28,29) |
| InChIKey | WJFFQISLWPSRHG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|