C30H41FN4O6S — CID 134195324
tert-butyl N-[3-[[5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl]oxy]propylsulfamoyl]carbamate (PubChem CID 134195324) has the molecular formula C30H41FN4O6S and a molecular weight of 604.75 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl]oxy]propylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl]oxy]propylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 134195324 |
| Molecular Formula | C30H41FN4O6S |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | tert-butyl N-[3-[[5-[2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)-1-hydroxyethyl]-2-adamantyl]oxy]propylsulfamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)NCCCOC1C2CC3CC1CC(C(O)CC1c4c(F)cccc4-c4cncn41)(C3)C2 |
| InChI | InChI=1S/C30H41FN4O6S/c1-29(2,3)41-28(37)34-42(38,39)33-8-5-9-40-27-19-10-18-11-20(27)15-30(13-18,14-19)25(36)12-23-26-21(6-4-7-22(26)31)24-16-32-17-35(23)24/h4,6-7,16-20,23,25,27,33,36H,5,8-15H2,1-3H3,(H,34,37) |
| InChIKey | QHOCOLKUGKYKAI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|