C28H33FN4O2 — CID 134195253
1-[2-(3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl)-2-azatricyclo[3.3.1.13,7]decan-5-yl]-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol (PubChem CID 134195253) has the molecular formula C28H33FN4O2 and a molecular weight of 476.60 g/mol. Its IUPAC name is 1-[2-(3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl)-2-azatricyclo[3.3.1.13,7]decan-5-yl]-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol.
| Compound Name | 1-[2-(3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl)-2-azatricyclo[3.3.1.13,7]decan-5-yl]-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol |
|---|---|
| PubChem CID | 134195253 |
| Molecular Formula | C28H33FN4O2 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 1-[2-(3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-yl)-2-azatricyclo[3.3.1.13,7]decan-5-yl]-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanol |
| SMILES | OC(CC1c2c(F)cccc2-c2cncn21)C12CC3CC(C1)N(C1=NC4CCCCC4O1)C(C3)C2 |
| InChI | InChI=1S/C28H33FN4O2/c29-20-5-3-4-19-23-14-30-15-32(23)22(26(19)20)10-25(34)28-11-16-8-17(12-28)33(18(9-16)13-28)27-31-21-6-1-2-7-24(21)35-27/h3-5,14-18,21-22,24-25,34H,1-2,6-13H2 |
| InChIKey | RQNBIYYLHQNNAI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |