C30H27FN4O3S — CID 134204950
[6-(2,3-dimethylphenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone (PubChem CID 134204950) has the molecular formula C30H27FN4O3S and a molecular weight of 542.64 g/mol. Its IUPAC name is [6-(2,3-dimethylphenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone.
| Compound Name | [6-(2,3-dimethylphenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 134204950 |
| Molecular Formula | C30H27FN4O3S |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | [6-(2,3-dimethylphenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone |
| SMILES | Cc1cccc(S(=O)(=O)N2CCC3=Cc4c(cnn4-c4ccc(F)cc4)CC3(C(=O)c3ccccn3)C2)c1C |
| InChI | InChI=1S/C30H27FN4O3S/c1-20-6-5-8-28(21(20)2)39(37,38)34-15-13-23-16-27-22(18-33-35(27)25-11-9-24(31)10-12-25)17-30(23,19-34)29(36)26-7-3-4-14-32-26/h3-12,14,16,18H,13,15,17,19H2,1-2H3 |
| InChIKey | HEBAEEWQLSYNQU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |