C28H20F4N4O3S — CID 72548675
[(4aR)-1-(4-fluorophenyl)-6-(2,3,4-trifluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone (PubChem CID 72548675) has the molecular formula C28H20F4N4O3S and a molecular weight of 568.55 g/mol. Its IUPAC name is [(4aR)-1-(4-fluorophenyl)-6-(2,3,4-trifluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone.
| Compound Name | [(4aR)-1-(4-fluorophenyl)-6-(2,3,4-trifluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 72548675 |
| Molecular Formula | C28H20F4N4O3S |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | [(4aR)-1-(4-fluorophenyl)-6-(2,3,4-trifluorophenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)c1ccc(F)c(F)c1F)C2 |
| InChI | InChI=1S/C28H20F4N4O3S/c29-19-4-6-20(7-5-19)36-23-13-18-10-12-35(40(38,39)24-9-8-21(30)25(31)26(24)32)16-28(18,14-17(23)15-34-36)27(37)22-3-1-2-11-33-22/h1-9,11,13,15H,10,12,14,16H2/t28-/m0/s1 |
| InChIKey | ZCUGHWJPHSEGKQ-NDEPHWFRSA-N |
| XLogP | 4.73 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|