C24H24N6O4 — CID 134207850
bis[(1S)-1-amino-1-(5-phenyl-1H-imidazol-2-yl)ethyl] oxalate (PubChem CID 134207850) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is bis[(1S)-1-amino-1-(5-phenyl-1H-imidazol-2-yl)ethyl] oxalate.
| Compound Name | bis[(1S)-1-amino-1-(5-phenyl-1H-imidazol-2-yl)ethyl] oxalate |
|---|---|
| PubChem CID | 134207850 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | bis[(1S)-1-amino-1-(5-phenyl-1H-imidazol-2-yl)ethyl] oxalate |
| SMILES | C[C@](N)(OC(=O)C(=O)O[C@](C)(N)c1ncc(-c2ccccc2)[nH]1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C24H24N6O4/c1-23(25,21-27-13-17(29-21)15-9-5-3-6-10-15)33-19(31)20(32)34-24(2,26)22-28-14-18(30-22)16-11-7-4-8-12-16/h3-14H,25-26H2,1-2H3,(H,27,29)(H,28,30)/t23-,24-/m0/s1 |
| InChIKey | PQFMEXWFMYKMJF-ZEQRLZLVSA-N |
| XLogP | 2.52 |
| TPSA | 162.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|