C22H27N3 — CID 154277388
1-phenyl-2-(5-phenyl-1H-imidazol-2-yl)heptan-2-amine (PubChem CID 154277388) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-phenyl-2-(5-phenyl-1H-imidazol-2-yl)heptan-2-amine.
| Compound Name | 1-phenyl-2-(5-phenyl-1H-imidazol-2-yl)heptan-2-amine |
|---|---|
| PubChem CID | 154277388 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 1-phenyl-2-(5-phenyl-1H-imidazol-2-yl)heptan-2-amine |
| SMILES | CCCCCC(N)(Cc1ccccc1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C22H27N3/c1-2-3-10-15-22(23,16-18-11-6-4-7-12-18)21-24-17-20(25-21)19-13-8-5-9-14-19/h4-9,11-14,17H,2-3,10,15-16,23H2,1H3,(H,24,25) |
| InChIKey | HAQWHAFPQPRCFK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|