C28H47N3 — CID 67214777
(1R)-N,N-dihexyl-1-(5-phenyl-1H-imidazol-2-yl)heptan-1-amine (PubChem CID 67214777) has the molecular formula C28H47N3 and a molecular weight of 425.71 g/mol. Its IUPAC name is (1R)-N,N-dihexyl-1-(5-phenyl-1H-imidazol-2-yl)heptan-1-amine.
| Compound Name | (1R)-N,N-dihexyl-1-(5-phenyl-1H-imidazol-2-yl)heptan-1-amine |
|---|---|
| PubChem CID | 67214777 |
| Molecular Formula | C28H47N3 |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 425.38 |
| IUPAC Name | (1R)-N,N-dihexyl-1-(5-phenyl-1H-imidazol-2-yl)heptan-1-amine |
| SMILES | CCCCCC[C@H](c1ncc(-c2ccccc2)[nH]1)N(CCCCCC)CCCCCC |
| InChI | InChI=1S/C28H47N3/c1-4-7-10-16-21-27(28-29-24-26(30-28)25-19-14-13-15-20-25)31(22-17-11-8-5-2)23-18-12-9-6-3/h13-15,19-20,24,27H,4-12,16-18,21-23H2,1-3H3,(H,29,30)/t27-/m1/s1 |
| InChIKey | CTZWKUYORHEUQJ-HHHXNRCGSA-N |
| XLogP | 8.55 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|