C23H28ClN3 — CID 10177913
N-[(2-chlorophenyl)methyl]-1-(5-phenyl-1H-imidazol-2-yl)heptan-1-amine (PubChem CID 10177913) has the molecular formula C23H28ClN3 and a molecular weight of 381.95 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-1-(5-phenyl-1H-imidazol-2-yl)heptan-1-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-1-(5-phenyl-1H-imidazol-2-yl)heptan-1-amine |
|---|---|
| PubChem CID | 10177913 |
| Molecular Formula | C23H28ClN3 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-1-(5-phenyl-1H-imidazol-2-yl)heptan-1-amine |
| SMILES | CCCCCCC(NCc1ccccc1Cl)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C23H28ClN3/c1-2-3-4-8-15-21(25-16-19-13-9-10-14-20(19)24)23-26-17-22(27-23)18-11-6-5-7-12-18/h5-7,9-14,17,21,25H,2-4,8,15-16H2,1H3,(H,26,27) |
| InChIKey | PQTVOTJDDSWJJD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|