C21H33N3 — CID 141036580
N-heptyl-N-pentyl-5-phenyl-1H-imidazol-2-amine (PubChem CID 141036580) has the molecular formula C21H33N3 and a molecular weight of 327.52 g/mol. Its IUPAC name is N-heptyl-N-pentyl-5-phenyl-1H-imidazol-2-amine.
| Compound Name | N-heptyl-N-pentyl-5-phenyl-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 141036580 |
| Molecular Formula | C21H33N3 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | N-heptyl-N-pentyl-5-phenyl-1H-imidazol-2-amine |
| SMILES | CCCCCCCN(CCCCC)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C21H33N3/c1-3-5-7-8-13-17-24(16-12-6-4-2)21-22-18-20(23-21)19-14-10-9-11-15-19/h9-11,14-15,18H,3-8,12-13,16-17H2,1-2H3,(H,22,23) |
| InChIKey | XHIKGAGYYFPLDT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|