C23H29N3 — CID 3709374
N,N-dibutyl-4,5-diphenyl-1H-imidazol-2-amine (PubChem CID 3709374) has the molecular formula C23H29N3 and a molecular weight of 347.51 g/mol. Its IUPAC name is N,N-dibutyl-4,5-diphenyl-1H-imidazol-2-amine.
| Compound Name | N,N-dibutyl-4,5-diphenyl-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 3709374 |
| Molecular Formula | C23H29N3 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | N,N-dibutyl-4,5-diphenyl-1H-imidazol-2-amine |
| SMILES | CCCCN(CCCC)c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C23H29N3/c1-3-5-17-26(18-6-4-2)23-24-21(19-13-9-7-10-14-19)22(25-23)20-15-11-8-12-16-20/h7-16H,3-6,17-18H2,1-2H3,(H,24,25) |
| InChIKey | CAAOAVSUOXGGOE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |