C21H26ClN3 — CID 70689162
5-(4-hexylphenyl)-4-phenyl-1H-imidazol-2-amine;hydrochloride (PubChem CID 70689162) has the molecular formula C21H26ClN3 and a molecular weight of 355.91 g/mol. Its IUPAC name is 5-(4-hexylphenyl)-4-phenyl-1H-imidazol-2-amine;hydrochloride.
| Compound Name | 5-(4-hexylphenyl)-4-phenyl-1H-imidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 70689162 |
| Molecular Formula | C21H26ClN3 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 5-(4-hexylphenyl)-4-phenyl-1H-imidazol-2-amine;hydrochloride |
| SMILES | CCCCCCc1ccc(-c2[nH]c(N)nc2-c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C21H25N3.ClH/c1-2-3-4-6-9-16-12-14-18(15-13-16)20-19(23-21(22)24-20)17-10-7-5-8-11-17;/h5,7-8,10-15H,2-4,6,9H2,1H3,(H3,22,23,24);1H |
| InChIKey | ZVEKWJJVYNJLBI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|