C21H25N3 — CID 141036518
N-benzyl-N-pentyl-5-phenyl-1H-imidazol-2-amine (PubChem CID 141036518) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-benzyl-N-pentyl-5-phenyl-1H-imidazol-2-amine.
| Compound Name | N-benzyl-N-pentyl-5-phenyl-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 141036518 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-benzyl-N-pentyl-5-phenyl-1H-imidazol-2-amine |
| SMILES | CCCCCN(Cc1ccccc1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C21H25N3/c1-2-3-10-15-24(17-18-11-6-4-7-12-18)21-22-16-20(23-21)19-13-8-5-9-14-19/h4-9,11-14,16H,2-3,10,15,17H2,1H3,(H,22,23) |
| InChIKey | GSZFJGMVCGYNHR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|