C18H26N4OS — CID 11688810
(2R)-2-amino-N-methyl-N-[(1S)-1-(5-phenyl-1H-imidazol-2-yl)pentyl]-3-sulfanylpropanamide (PubChem CID 11688810) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is (2R)-2-amino-N-methyl-N-[(1S)-1-(5-phenyl-1H-imidazol-2-yl)pentyl]-3-sulfanylpropanamide.
| Compound Name | (2R)-2-amino-N-methyl-N-[(1S)-1-(5-phenyl-1H-imidazol-2-yl)pentyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 11688810 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (2R)-2-amino-N-methyl-N-[(1S)-1-(5-phenyl-1H-imidazol-2-yl)pentyl]-3-sulfanylpropanamide |
| SMILES | CCCC[C@@H](c1ncc(-c2ccccc2)[nH]1)N(C)C(=O)[C@@H](N)CS |
| InChI | InChI=1S/C18H26N4OS/c1-3-4-10-16(22(2)18(23)14(19)12-24)17-20-11-15(21-17)13-8-6-5-7-9-13/h5-9,11,14,16,24H,3-4,10,12,19H2,1-2H3,(H,20,21)/t14-,16-/m0/s1 |
| InChIKey | USLNTELLRYNNFO-HOCLYGCPSA-N |
| XLogP | 3.02 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|