C18H25N3O2 — CID 67214955
tert-butyl-[(1R)-1-(5-phenyl-1H-imidazol-2-yl)butyl]carbamic acid (PubChem CID 67214955) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is tert-butyl-[(1R)-1-(5-phenyl-1H-imidazol-2-yl)butyl]carbamic acid.
| Compound Name | tert-butyl-[(1R)-1-(5-phenyl-1H-imidazol-2-yl)butyl]carbamic acid |
|---|---|
| PubChem CID | 67214955 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | tert-butyl-[(1R)-1-(5-phenyl-1H-imidazol-2-yl)butyl]carbamic acid |
| SMILES | CCC[C@H](c1ncc(-c2ccccc2)[nH]1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C18H25N3O2/c1-5-9-15(21(17(22)23)18(2,3)4)16-19-12-14(20-16)13-10-7-6-8-11-13/h6-8,10-12,15H,5,9H2,1-4H3,(H,19,20)(H,22,23)/t15-/m1/s1 |
| InChIKey | CXGOCUBIPVMGMW-OAHLLOKOSA-N |
| XLogP | 4.70 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |