About [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid
[3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid (PubChem CID 69443380) has the molecular formula C22H25N3O2
and a molecular weight of 363.46 g/mol. Its IUPAC name is [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid.
Molecular Properties
| Compound Name | [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid |
| PubChem CID | 69443380 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid |
| SMILES | CC(C)(C)C(CNC(=O)O)c1ncc(-c2ccc(-c3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C22H25N3O2/c1-22(2,3)18(13-24-21(26)27)20-23-14-19(25-20)17-11-9-16(10-12-17)15-7-5-4-6-8-15/h4-12,14,18,24H,13H2,1-3H3,(H,23,25)(H,26,27) |
| InChIKey | TWAJUECWJWHILA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid?
The IUPAC name of [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid (CID 69443380) is [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid.
What is the SMILES notation for [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid?
The canonical SMILES for [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid is CC(C)(C)C(CNC(=O)O)c1ncc(-c2ccc(-c3ccccc3)cc2)[nH]1.
What is the InChIKey of [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid?
The InChIKey is TWAJUECWJWHILA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O2/c1-22(2,3)18(13-24-21(26)27)20-23-14-19(25-20)17-11-9-16(10-12-17)15-7-5-4-6-8-15/h4-12,14,18,24H,13H2,1-3H3,(H,23,25)(H,26,27).
What are the key properties of [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid?
[3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid has a molecular weight of 363.46 g/mol, XLogP of 5.14, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3-dimethyl-2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]butyl]carbamic acid is sourced from PubChem (CID 69443380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).