C22H33N3O3 — CID 67213698
tert-butyl-[(1R)-1-[5-(2-methoxyphenyl)-1H-imidazol-2-yl]heptyl]carbamic acid (PubChem CID 67213698) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is tert-butyl-[(1R)-1-[5-(2-methoxyphenyl)-1H-imidazol-2-yl]heptyl]carbamic acid.
| Compound Name | tert-butyl-[(1R)-1-[5-(2-methoxyphenyl)-1H-imidazol-2-yl]heptyl]carbamic acid |
|---|---|
| PubChem CID | 67213698 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | tert-butyl-[(1R)-1-[5-(2-methoxyphenyl)-1H-imidazol-2-yl]heptyl]carbamic acid |
| SMILES | CCCCCC[C@H](c1ncc(-c2ccccc2OC)[nH]1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C22H33N3O3/c1-6-7-8-9-13-18(25(21(26)27)22(2,3)4)20-23-15-17(24-20)16-12-10-11-14-19(16)28-5/h10-12,14-15,18H,6-9,13H2,1-5H3,(H,23,24)(H,26,27)/t18-/m1/s1 |
| InChIKey | CESUKYXOWJQXON-GOSISDBHSA-N |
| XLogP | 5.88 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|