C16H18IN7OS — CID 134208785
4-(6-amino-2-iodopurin-9-yl)-N-(4-methyl-1,3-thiazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 134208785) has the molecular formula C16H18IN7OS and a molecular weight of 483.34 g/mol. Its IUPAC name is 4-(6-amino-2-iodopurin-9-yl)-N-(4-methyl-1,3-thiazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-(6-amino-2-iodopurin-9-yl)-N-(4-methyl-1,3-thiazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 134208785 |
| Molecular Formula | C16H18IN7OS |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 4-(6-amino-2-iodopurin-9-yl)-N-(4-methyl-1,3-thiazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | Cc1csc(NC(=O)C2CCC(n3cnc4c(N)nc(I)nc43)CC2)n1 |
| InChI | InChI=1S/C16H18IN7OS/c1-8-6-26-16(20-8)23-14(25)9-2-4-10(5-3-9)24-7-19-11-12(18)21-15(17)22-13(11)24/h6-7,9-10H,2-5H2,1H3,(H2,18,21,22)(H,20,23,25) |
| InChIKey | QSDGZXHTCJPOHD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|