C17H13Cl2F4NO4 — CID 134209488
ethyl 2-[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-fluorophenoxy]-2-methoxyacetate (PubChem CID 134209488) has the molecular formula C17H13Cl2F4NO4 and a molecular weight of 442.19 g/mol. Its IUPAC name is ethyl 2-[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-fluorophenoxy]-2-methoxyacetate.
| Compound Name | ethyl 2-[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-fluorophenoxy]-2-methoxyacetate |
|---|---|
| PubChem CID | 134209488 |
| Molecular Formula | C17H13Cl2F4NO4 |
| Molecular Weight | 442.19 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | ethyl 2-[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-fluorophenoxy]-2-methoxyacetate |
| SMILES | CCOC(=O)C(OC)Oc1cc(-c2ncc(C(F)(F)F)cc2Cl)c(F)cc1Cl |
| InChI | InChI=1S/C17H13Cl2F4NO4/c1-3-27-15(25)16(26-2)28-13-5-9(12(20)6-10(13)18)14-11(19)4-8(7-24-14)17(21,22)23/h4-7,16H,3H2,1-2H3 |
| InChIKey | ZMXRKSHLSPZSJA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|