C14H9Cl4F3N4 — CID 134210964
1-(2,4-dichlorophenyl)-N-[[1-(3,5-dichloropyrazin-2-yl)-2,2,2-trifluoroethylidene]amino]ethanamine (PubChem CID 134210964) has the molecular formula C14H9Cl4F3N4 and a molecular weight of 432.06 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[[1-(3,5-dichloropyrazin-2-yl)-2,2,2-trifluoroethylidene]amino]ethanamine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[[1-(3,5-dichloropyrazin-2-yl)-2,2,2-trifluoroethylidene]amino]ethanamine |
|---|---|
| PubChem CID | 134210964 |
| Molecular Formula | C14H9Cl4F3N4 |
| Molecular Weight | 432.06 g/mol |
| Exact Mass | 429.95 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[[1-(3,5-dichloropyrazin-2-yl)-2,2,2-trifluoroethylidene]amino]ethanamine |
| SMILES | CC(NN=C(c1ncc(Cl)nc1Cl)C(F)(F)F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl4F3N4/c1-6(8-3-2-7(15)4-9(8)16)24-25-12(14(19,20)21)11-13(18)23-10(17)5-22-11/h2-6,24H,1H3 |
| InChIKey | NWDABNYZJOKYTL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.06 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|