C16H33N3O — CID 134214478
4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)morpholine (PubChem CID 134214478) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)morpholine.
| Compound Name | 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)morpholine |
|---|---|
| PubChem CID | 134214478 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)morpholine |
| SMILES | CC(C)(CCC(C)(C)N1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H33N3O/c1-15(2,18-9-7-17-8-10-18)5-6-16(3,4)19-11-13-20-14-12-19/h17H,5-14H2,1-4H3 |
| InChIKey | COMDNJGRLJOWDD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |