C24H36N6O3 — CID 134215594
1-[3-[4-(tert-butylamino)-5-methanimidoyl-6-(oxan-4-ylamino)pyrimidin-2-yl]phenoxy]-3-(methylamino)propan-2-ol (PubChem CID 134215594) has the molecular formula C24H36N6O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-[3-[4-(tert-butylamino)-5-methanimidoyl-6-(oxan-4-ylamino)pyrimidin-2-yl]phenoxy]-3-(methylamino)propan-2-ol.
| Compound Name | 1-[3-[4-(tert-butylamino)-5-methanimidoyl-6-(oxan-4-ylamino)pyrimidin-2-yl]phenoxy]-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 134215594 |
| Molecular Formula | C24H36N6O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 1-[3-[4-(tert-butylamino)-5-methanimidoyl-6-(oxan-4-ylamino)pyrimidin-2-yl]phenoxy]-3-(methylamino)propan-2-ol |
| SMILES | [H]/N=C/c1c(NC2CCOCC2)nc(-c2cccc(OCC(O)CNC)c2)nc1NC(C)(C)C |
| InChI | InChI=1S/C24H36N6O3/c1-24(2,3)30-23-20(13-25)22(27-17-8-10-32-11-9-17)28-21(29-23)16-6-5-7-19(12-16)33-15-18(31)14-26-4/h5-7,12-13,17-18,25-26,31H,8-11,14-15H2,1-4H3,(H2,27,28,29,30)/b25-13+ |
| InChIKey | ZNKFMBYEGMZJNB-DHRITJCHSA-N |
| XLogP | 2.90 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|